CAS 53391-77-8 is the registry number for 8-Chloro-7-hydroxy-2,3-dihydrocyclopenta[c]chromen-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-chloro-7-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (CAS 53391-77-8) is a chemical compound with the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. IUPAC name: 8-chloro-7-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one. InChIKey: HETUGUSWOXYKSY-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 8-chloro-7-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| InChIKey | HETUGUSWOXYKSY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=O)OC3=CC(=C(C=C23)Cl)O |
Computed by PubChem (NCBI)