CAS 4449-28-9 is the registry number for Trifluridine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
Furan-2-ylmethyl 4-chlorobenzoate (CAS 4449-28-9) is a chemical compound with the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. IUPAC name: furan-2-ylmethyl 4-chlorobenzoate. InChIKey: ZOTNUHCCBPJKLO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | furan-2-ylmethyl 4-chlorobenzoate |
| InChIKey | ZOTNUHCCBPJKLO-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)COC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)