Products 874787-49-2

CAS 874787-49-2 is the registry number for (2E)-3-(6-Chloro-2h-chromen-3-yl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoic acid (CAS 874787-49-2) is a chemical compound with the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. IUPAC name: (E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoic acid. InChIKey: ZJGKTNRMAWNURS-DAFODLJHSA-N.

Identity
Molecular formulaC12H9ClO3
Molecular weight236.65 g/mol
IUPAC name(E)-3-(6-chloro-2H-chromen-3-yl)prop-2-enoic acid
InChIKeyZJGKTNRMAWNURS-DAFODLJHSA-N
SMILESC1C(=CC2=C(O1)C=CC(=C2)Cl)/C=C/C(=O)O

Computed by PubChem (NCBI)