cas: 98142-23-5 — see every product listed under this CAS number, including other names
5-Chloro-N-methyl-3-nitropyridin-2-amine 98% (CAS 98142-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2835360-100mg |
| cas | 98142-23-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 1977.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2835360 |
5-chloro-N-methyl-3-nitropyridin-2-amine (CAS 98142-23-5) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-N-methyl-3-nitropyridin-2-amine. InChIKey: SYQICYDWDKINOO-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-N-methyl-3-nitropyridin-2-amine |
| InChIKey | SYQICYDWDKINOO-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)