cas: 733790-54-0 — see every product listed under this CAS number, including other names
5-Cyclopropyl-4-phenyl-4H-1,2,4-triazole-3-thiol, 98%, 98% (CAS 733790-54-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JABI-100mg |
| cas | 733790-54-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 842.00 Pln | |
| Chemat | 1g | 2018.00 Pln | |
| Chemat | 5g | 6318.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-cyclopropyl-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 733790-54-0) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 3-cyclopropyl-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: WLGLHDYAQXRRMM-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 3-cyclopropyl-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | WLGLHDYAQXRRMM-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)