CAS 72596-74-8 appears in our catalog under these names: PD-404182, PD 404182, PD 404182, 3,4-Dihydro-2H,6H-pyrimido(1,2-c)(1,3)benzothiazin-6-imine, PD 404182, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine (CAS 72596-74-8) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine. InChIKey: JNENSSREQFBZGT-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| InChIKey | JNENSSREQFBZGT-UHFFFAOYSA-N |
| SMILES | C1CN=C2C3=CC=CC=C3SC(=N)N2C1 |
Computed by PubChem (NCBI)