CAS 1698488-18-4 is the registry number for 5-(2,3-Dihydro-1H-inden-2-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3-dihydro-1H-inden-2-yl)-1,3,4-thiadiazol-2-amine (CAS 1698488-18-4) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 5-(2,3-dihydro-1H-inden-2-yl)-1,3,4-thiadiazol-2-amine. InChIKey: STBCAQUIAHJLGX-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 5-(2,3-dihydro-1H-inden-2-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | STBCAQUIAHJLGX-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)C3=NN=C(S3)N |
Computed by PubChem (NCBI)