CAS 95469-88-8 is the registry number for 2-Phenyl-2,6-dihydro-4h-thieno[3,4-c]pyrazol-3-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine (CAS 95469-88-8) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine. InChIKey: PVKVTEYRFBNYMQ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-amine |
| InChIKey | PVKVTEYRFBNYMQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(N(N=C2CS1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)