5-Fluoro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 96%, 96%
cas: 703-95-7 — see every product listed under this CAS number, including other names
5-Fluoro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 96%, 96% (CAS 703-95-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MRR-1g |
| cas | 703-95-7 |
| size | 1g |
| availability | 500g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 25g | 1365.20 Pln | |
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 250g | 10758.80 Pln | |
| Chemat | 500g | 17548.80 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 703-95-7) is a chemical compound with the molecular formula C5H3FN2O4 and a molecular weight of 174.09 g/mol. IUPAC name: 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SEHFUALWMUWDKS-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O4 |
|---|---|
| Molecular weight | 174.09 g/mol |
| IUPAC name | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SEHFUALWMUWDKS-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
5-Fluoroorotic acid, Fluoroorotic acid, Orotic acid, 5-fluoro-, Ro 2-9945, 1,2,3,6-Tetrahydro-2,6-dioxo-5-fluoro-4-pyrimidinecarboxylic acid, 5-Fluoro-1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid, 5-fluoro-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 5-Fluoroorotate, 5-Fluoro orotic acid, 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid