CAS 703-95-7 appears in our catalog under these names: 5-Fluoroorotic acid, 97%, 5-Fluoroorotic acid/ 100%, Fluoroorotic Acid, Ultra Pure, 5-Fluoroorotic acid, 5-Fluoroorotic acid potassium salt. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 50mg, 100mg, 200mg, 500mg.
5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 703-95-7) is a chemical compound with the molecular formula C5H3FN2O4 and a molecular weight of 174.09 g/mol. IUPAC name: 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SEHFUALWMUWDKS-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O4 |
|---|---|
| Molecular weight | 174.09 g/mol |
| IUPAC name | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SEHFUALWMUWDKS-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |
Computed by PubChem (NCBI)