cas: 703-95-7 — see every product listed under this CAS number, including other names
5-Fluoroorotic acid, 99.99% (CAS 703-95-7) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W016819-10mM/1mL |
| cas | 703-95-7 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 542.60 Pln | |
| MedChemExpress | 500 mg | 263.96 Pln | |
| MedChemExpress | 1 g | 361.49 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.99% |
5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 703-95-7) is a chemical compound with the molecular formula C5H3FN2O4 and a molecular weight of 174.09 g/mol. IUPAC name: 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SEHFUALWMUWDKS-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O4 |
|---|---|
| Molecular weight | 174.09 g/mol |
| IUPAC name | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SEHFUALWMUWDKS-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |
Computed by PubChem (NCBI)