cas: 703-95-7 — see every product listed under this CAS number, including other names
5-Fluoroorotic acid, 98% (CAS 703-95-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M02721-10G |
| cas | 703-95-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 893.45 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 487.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 703-95-7) is a chemical compound with the molecular formula C5H3FN2O4 and a molecular weight of 174.09 g/mol. IUPAC name: 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: SEHFUALWMUWDKS-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O4 |
|---|---|
| Molecular weight | 174.09 g/mol |
| IUPAC name | 5-fluoro-2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| InChIKey | SEHFUALWMUWDKS-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |
Computed by PubChem (NCBI)