cas: 1096880-75-9 — see every product listed under this CAS number, including other names
5-Fluoro-2-morpholinobenzoic acid, >97%, >97% (CAS 1096880-75-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103YM-250mg |
| cas | 1096880-75-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 5g | 2680.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-morpholin-4-ylbenzoic acid (CAS 1096880-75-9) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: 5-fluoro-2-morpholin-4-ylbenzoic acid. InChIKey: WNAOSSZZNGQFBY-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 5-fluoro-2-morpholin-4-ylbenzoic acid |
| InChIKey | WNAOSSZZNGQFBY-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)