cas: 847902-56-1 — see every product listed under this CAS number, including other names
5-Fluoro-2-nitropyridin-3-ol, 95%, 95% (CAS 847902-56-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0XP-100mg |
| cas | 847902-56-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2190.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-nitropyridin-3-ol (CAS 847902-56-1) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 5-fluoro-2-nitropyridin-3-ol. InChIKey: XCYLKKXQKCXJAE-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 5-fluoro-2-nitropyridin-3-ol |
| InChIKey | XCYLKKXQKCXJAE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)