CAS 136888-20-5 appears in our catalog under these names: 5–Fluoro–2–hydroxy–3–nitropyridine, 5-Fluoro-2-hydroxy-3-nitropyridine, 98%, 5-Fluoro-3-nitropyridin-2(1H)-one 95%, 5-Fluoro-3-nitropyridin-2(1H)-one, 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
5-fluoro-3-nitro-1H-pyridin-2-one (CAS 136888-20-5) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 5-fluoro-3-nitro-1H-pyridin-2-one. InChIKey: BLFUHTOZIOQGBU-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 5-fluoro-3-nitro-1H-pyridin-2-one |
| InChIKey | BLFUHTOZIOQGBU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)