CAS 1806474-44-1 is the registry number for 4-Fluoro-2-hydroxy-5-nitropyridine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-5-nitro-1H-pyridin-2-one (CAS 1806474-44-1) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 4-fluoro-5-nitro-1H-pyridin-2-one. InChIKey: LGKVGXWQBZDXRI-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 4-fluoro-5-nitro-1H-pyridin-2-one |
| InChIKey | LGKVGXWQBZDXRI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CNC1=O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)