Products 1079990-21-8
CAS 1079990-21-8 appears in our catalog under these names: Favipiravir Impurity 9, Favipiravir Carboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 25mg.
5-fluoro-2-oxo-1H-pyrazine-3-carboxylic acid (CAS 1079990-21-8) is a chemical compound with the molecular formula C5H3FN2O3 and a molecular weight of 158.09 g/mol. IUPAC name: 5-fluoro-2-oxo-1H-pyrazine-3-carboxylic acid. InChIKey: WNYMULLJEWQQPZ-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O3 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 5-fluoro-2-oxo-1H-pyrazine-3-carboxylic acid |
| InChIKey | WNYMULLJEWQQPZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=O)N1)C(=O)O)F |
Computed by PubChem (NCBI)