cas: 1197193-39-7 — see every product listed under this CAS number, including other names
5-Fluoro-2-piperazinobenzoic Acid, >97%, >97% (CAS 1197193-39-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PJU-1g |
| cas | 1197193-39-7 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1264.40 Pln | |
| Chemat | 5g | 4398.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
5-fluoro-2-piperazin-1-ylbenzoic acid (CAS 1197193-39-7) is a chemical compound with the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. IUPAC name: 5-fluoro-2-piperazin-1-ylbenzoic acid. InChIKey: YFHIYLRCMPTEGK-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O2 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | 5-fluoro-2-piperazin-1-ylbenzoic acid |
| InChIKey | YFHIYLRCMPTEGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)