5-Formyl-2-methylphenylboronic acid, 95+%, 95+%
cas: 1186398-35-5 — see every product listed under this CAS number, including other names
5-Formyl-2-methylphenylboronic acid, 95+%, 95+% (CAS 1186398-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1191ZW-100mg |
| cas | 1186398-35-5 |
| size | 100mg |
| availability | 6g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(5-formyl-2-methylphenyl)boronic acid (CAS 1186398-35-5) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (5-formyl-2-methylphenyl)boronic acid. InChIKey: VBQDWWUYMAWKHV-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (5-formyl-2-methylphenyl)boronic acid |
| InChIKey | VBQDWWUYMAWKHV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)