5-Iodo-2-methyl-3-nitrobenzoic acid, 98%
cas: 1517254-24-8 — see every product listed under this CAS number, including other names
5-Iodo-2-methyl-3-nitrobenzoic acid, 98% (CAS 1517254-24-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1489293-10g |
| cas | 1517254-24-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12360.88 Pln | |
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2247.14 Pln | |
| Fluorochem | 5g | 6443.58 Pln | |
| Fluorochem | 10g | 7146.46 Pln | |
| Fluorochem | 25g | 14945.80 Pln | |
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1173.20 Pln | |
| Chemat | 5g | 3918.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-iodo-2-methyl-3-nitrobenzoic acid (CAS 1517254-24-8) is a chemical compound with the molecular formula C8H6INO4 and a molecular weight of 307.04 g/mol. IUPAC name: 5-iodo-2-methyl-3-nitrobenzoic acid. InChIKey: NJSFPDASNUPKBB-UHFFFAOYSA-N.
| Molecular formula | C8H6INO4 |
|---|---|
| Molecular weight | 307.04 g/mol |
| IUPAC name | 5-iodo-2-methyl-3-nitrobenzoic acid |
| InChIKey | NJSFPDASNUPKBB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])I)C(=O)O |
Computed by PubChem (NCBI)