CAS 31252-85-4 appears in our catalog under these names: 4-Nitrophenyl iodoacetate, 4-Nitrophenyl iodoacetate, 95%, p-Nitrophenyl Iodoacetate, p-Nitrophenyl Iodoacetate, 99%, 99%. Offered by: Biosynth, Combi-blocks, TRC, Chemat. Available pack sizes: 250mg, 500mg, 1000mg, 2000mg, 5g, 1g, 2,5g, 100mg.
(4-nitrophenyl) 2-iodoacetate (CAS 31252-85-4) is a chemical compound with the molecular formula C8H6INO4 and a molecular weight of 307.04 g/mol. IUPAC name: (4-nitrophenyl) 2-iodoacetate. InChIKey: GERXSZLDSOPHJV-UHFFFAOYSA-N.
| Molecular formula | C8H6INO4 |
|---|---|
| Molecular weight | 307.04 g/mol |
| IUPAC name | (4-nitrophenyl) 2-iodoacetate |
| InChIKey | GERXSZLDSOPHJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)CI |
Computed by PubChem (NCBI)