Products 112239-00-6
CAS 112239-00-6 appears in our catalog under these names: Methyl 2-iodo-5-nitrobenzoate 98%, Methyl 2-iodo-5-nitrobenzoate, 96%, 96%, Methyl 2-iodo-5-nitrobenzoate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
Methyl 2-iodo-5-nitrobenzoate (CAS 112239-00-6) is a chemical compound with the molecular formula C8H6INO4 and a molecular weight of 307.04 g/mol. IUPAC name: methyl 2-iodo-5-nitrobenzoate. InChIKey: INEMMZILZDRYJK-UHFFFAOYSA-N.
| Molecular formula | C8H6INO4 |
|---|---|
| Molecular weight | 307.04 g/mol |
| IUPAC name | methyl 2-iodo-5-nitrobenzoate |
| InChIKey | INEMMZILZDRYJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)