CAS 1021493-53-7 appears in our catalog under these names: 3-Methoxy-4-iodo-5-nitro-benzaldehyde, 98%, 4-Iodo-3-methoxy-5-nitrobenzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-iodo-3-methoxy-5-nitrobenzaldehyde (CAS 1021493-53-7) is a chemical compound with the molecular formula C8H6INO4 and a molecular weight of 307.04 g/mol. IUPAC name: 4-iodo-3-methoxy-5-nitrobenzaldehyde. InChIKey: WVDDJASTMZNUNH-UHFFFAOYSA-N.
| Molecular formula | C8H6INO4 |
|---|---|
| Molecular weight | 307.04 g/mol |
| IUPAC name | 4-iodo-3-methoxy-5-nitrobenzaldehyde |
| InChIKey | WVDDJASTMZNUNH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1I)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)