cas: 89791-96-8 — see every product listed under this CAS number, including other names
5-Methyl-3-nitrobenzene-1,2-diol, 97%, 97% (CAS 89791-96-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FY0C-50mg |
| cas | 89791-96-8 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 246.80 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1763.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methyl-3-nitrocatechol is a methylcatechol that is 3-nitrocatechol carrying a methyl substituent at position 5. It is a methylcatechol and a nitrotoluene.
Source: ChEBI
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5-methyl-3-nitrobenzene-1,2-diol |
| InChIKey | MQGZDMVKFBSAQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)