CAS 34112-74-8 appears in our catalog under these names: 3-(Hydroxymethyl)-2-nitrophenol, 95%, 3-Hydroxy-2-nitrobenzyl alcohol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, 100g.
3-(hydroxymethyl)-2-nitrophenol (CAS 34112-74-8) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 3-(hydroxymethyl)-2-nitrophenol. InChIKey: DCEWMNYPPSLSLQ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 3-(hydroxymethyl)-2-nitrophenol |
| InChIKey | DCEWMNYPPSLSLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)