CAS 7145-49-5 appears in our catalog under these names: 3-Methoxy-5-nitrophenol, 95%, 3-Methoxy-5-nitrophenol 95+%, 3-METHOXY-5-NITROPHENOL, 98%, 3-Methoxy-5-nitrophenol, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
3-methoxy-5-nitrophenol (CAS 7145-49-5) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 3-methoxy-5-nitrophenol. InChIKey: YETHUNXROLCEGJ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 3-methoxy-5-nitrophenol |
| InChIKey | YETHUNXROLCEGJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)