CAS 846557-80-0 is the registry number for 2,4-Dihydroxy-6-methylpyridine-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 846557-80-0) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: AEZBEQWWMNSAGB-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 4-hydroxy-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | AEZBEQWWMNSAGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)O)O |
Computed by PubChem (NCBI)