cas: 16883-16-2 — see every product listed under this CAS number, including other names
5-Methyl-3-phenylisoxazole-4-carbonyl Chloride, >98.0%(GC)(T) (CAS 16883-16-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2996-1G |
| cas | 16883-16-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 208.35 Pln | |
| TCI | 5g | 459.12 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride (CAS 16883-16-2) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride. InChIKey: HXEVQMXCHCDPSO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)