cas: 16883-16-2 — see every product listed under this CAS number, including other names
5-Methyl-3-phenylisoxazole-4-carbonyl chloride, 90% (CAS 16883-16-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC00502DA |
| cas | 16883-16-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 92.14 Pln | |
| Thermo Scientific | 10g | 661.80 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride (CAS 16883-16-2) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride. InChIKey: HXEVQMXCHCDPSO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 5-methyl-3-phenyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)