cas: 858206-54-9 — see every product listed under this CAS number, including other names
5-Methyl-5-(thiophen-3-yl)imidazolidine-2,4-dione 95% (CAS 858206-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1115344-100mg |
| cas | 858206-54-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 960.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1115344 |
5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione (CAS 858206-54-9) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione. InChIKey: PUTWZZJHSOQALV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
| InChIKey | PUTWZZJHSOQALV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CSC=C2 |
Computed by PubChem (NCBI)