cas: 1369170-24-0 — see every product listed under this CAS number, including other names
5-Methylnaphtho[1,2-d]thiazol-2-amine, 98% (CAS 1369170-24-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01376269-5mg |
| cas | 1369170-24-0 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 5mg | 625.36 Pln | |
| BLDpharm | 10mg | 897.49 Pln | |
| BLDpharm | 25mg | 1636.12 Pln | |
| BLDpharm | 50mg | 2730.17 Pln | |
| BLDpharm | 100mg | 4590.63 Pln | |
| Chemat | 5mg | 606.80 Pln | |
| Chemat | 10mg | 875.60 Pln | |
| Chemat | 25mg | 1610.00 Pln | |
| Chemat | 50mg | 2690.00 Pln | |
| Chemat | 100mg | 4528.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-methylbenzo[e][1,3]benzothiazol-2-amine (CAS 1369170-24-0) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: 5-methylbenzo[e][1,3]benzothiazol-2-amine. InChIKey: JQZQMZXXJFFVFE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 5-methylbenzo[e][1,3]benzothiazol-2-amine |
| InChIKey | JQZQMZXXJFFVFE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C13)N=C(S2)N |
Computed by PubChem (NCBI)