CAS 1369170-24-0 appears in our catalog under these names: SKA-111, 98%, SKA-111/ 99.79% (existing batch purity), SKA–111, 5-Methylnaphtho(1,2-d)thiazol-2-amine, 5-Methylnaphtho[1,2-d]thiazol-2-amine, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
5-methylbenzo[e][1,3]benzothiazol-2-amine (CAS 1369170-24-0) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: 5-methylbenzo[e][1,3]benzothiazol-2-amine. InChIKey: JQZQMZXXJFFVFE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 5-methylbenzo[e][1,3]benzothiazol-2-amine |
| InChIKey | JQZQMZXXJFFVFE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C13)N=C(S2)N |
Computed by PubChem (NCBI)