cas: 1187932-31-5 — see every product listed under this CAS number, including other names
5-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95% (CAS 1187932-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464866-100MG |
| cas | 1187932-31-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 664.37 Pln | |
| Fluorochem | 1g | 752.88 Pln | |
| Fluorochem | 2.5g | 1794.18 Pln | |
| Fluorochem | 5g | 3533.15 Pln | |
| Fluorochem | 10g | 5787.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1187932-31-5) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: HFEFGAMDARONNT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | HFEFGAMDARONNT-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)