cas: 73458-39-6 — see every product listed under this CAS number, including other names
5-Nitro-benzothiazol-2-ylamine, 97% (CAS 73458-39-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030097-250MG |
| cas | 73458-39-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1919.13 Pln | |
| Fluorochem | 25g | 4527.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-nitro-1,3-benzothiazol-2-amine (CAS 73458-39-6) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,3-benzothiazol-2-amine. InChIKey: FISVWAMPAATJLP-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,3-benzothiazol-2-amine |
| InChIKey | FISVWAMPAATJLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(S2)N |
Computed by PubChem (NCBI)