cas: 84387-89-3 — see every product listed under this CAS number, including other names
5-Nitrobenzo[d]isothiazol-3-amine, 96%, 96% (CAS 84387-89-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MX5-1g |
| cas | 84387-89-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 25g | 597.20 Pln | |
| Chemat | 250mg | 93.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1,2-benzothiazol-3-amine (CAS 84387-89-3) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,2-benzothiazol-3-amine. InChIKey: LDTCWISGJYTXDC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,2-benzothiazol-3-amine |
| InChIKey | LDTCWISGJYTXDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=NS2)N |
Computed by PubChem (NCBI)