cas: 84387-89-3 — see every product listed under this CAS number, including other names
5-Nitrobenzo[d]isothiazol-3-amine, 96% (CAS 84387-89-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319880-5G |
| cas | 84387-89-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 445.69 Pln | |
| Fluorochem | 25g | 732.05 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-1,2-benzothiazol-3-amine (CAS 84387-89-3) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,2-benzothiazol-3-amine. InChIKey: LDTCWISGJYTXDC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,2-benzothiazol-3-amine |
| InChIKey | LDTCWISGJYTXDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=NS2)N |
Computed by PubChem (NCBI)