cas: 73458-39-6 — see every product listed under this CAS number, including other names
5-Nitrobenzo[d]thiazol-2-amine, 95%, 95% (CAS 73458-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MX6-100mg |
| cas | 73458-39-6 |
| size | 100mg |
| availability | 25.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 726.80 Pln | |
| Chemat | 10g | 1384.40 Pln | |
| Chemat | 25g | 2310.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1,3-benzothiazol-2-amine (CAS 73458-39-6) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,3-benzothiazol-2-amine. InChIKey: FISVWAMPAATJLP-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,3-benzothiazol-2-amine |
| InChIKey | FISVWAMPAATJLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(S2)N |
Computed by PubChem (NCBI)