Products 6146-52-7
CAS 6146-52-7 appears in our catalog under these names: 5-Nitroindole, 96%, 5–Nitroindole, 5-Nitroindole/ 98+%, 5-Nitroindole, 99% , 5-Nitroindole, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 250g, 1000g, 2000g.
5-nitro-1H-indole (CAS 6146-52-7) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-nitro-1H-indole. InChIKey: OZFPSOBLQZPIAV-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-nitro-1H-indole |
| InChIKey | OZFPSOBLQZPIAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)