cas: 82827-08-5 — see every product listed under this CAS number, including other names
5-Nitroisoquinolin-1(2H)-one, 97% (CAS 82827-08-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A229896-10g |
| cas | 82827-08-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13552.21 Pln | |
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 258.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-nitro-2H-isoquinolin-1-one (CAS 82827-08-5) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 5-nitro-2H-isoquinolin-1-one. InChIKey: GMDPUTAUKHHDCI-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-nitro-2H-isoquinolin-1-one |
| InChIKey | GMDPUTAUKHHDCI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CNC2=O)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)