Products 912577-30-1
CAS 912577-30-1 appears in our catalog under these names: 3-(1,2,4-Oxadiazol-3-yl)benzoic acid, 95%, 3-(1,2,4-Oxadiazol-3-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
3-(1,2,4-oxadiazol-3-yl)benzoic acid (CAS 912577-30-1) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-(1,2,4-oxadiazol-3-yl)benzoic acid. InChIKey: NZZZFWKBYIYYQN-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-(1,2,4-oxadiazol-3-yl)benzoic acid |
| InChIKey | NZZZFWKBYIYYQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NOC=N2 |
Computed by PubChem (NCBI)