CAS 885519-98-2 appears in our catalog under these names: 3-Formyl-1h-indazole-5-carboxylic acid, 95%, 3-Formyl-1H-indazole-5-carboxylic Acid, 3-Formyl-1H-indazole-5-carboxylic acid 97%, 3-Formyl-1H-indazole-5-carboxylic acid, 97%, 97%, 1H-INDAZOLE-5-CARBOXYLIC ACID, 3-FORMYL-, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g, 10g.
3-formyl-2H-indazole-5-carboxylic acid (CAS 885519-98-2) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-formyl-2H-indazole-5-carboxylic acid. InChIKey: MAPWHWRNFRJKFI-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-formyl-2H-indazole-5-carboxylic acid |
| InChIKey | MAPWHWRNFRJKFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1C(=O)O)C=O |
Computed by PubChem (NCBI)