CAS 4901-93-3 is the registry number for 4-Oxo-1,4-dihydro-1,5-naphthyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-oxo-1H-1,5-naphthyridine-3-carboxylic acid (CAS 4901-93-3) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 4-oxo-1H-1,5-naphthyridine-3-carboxylic acid. InChIKey: LODIKMSUDZMCFF-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 4-oxo-1H-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | LODIKMSUDZMCFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C(=CN2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)