cas: 2047-49-6 — see every product listed under this CAS number, including other names
5-Nitronicotinic acid, 95% (CAS 2047-49-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223348-250MG |
| cas | 2047-49-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1221.46 Pln | |
| Fluorochem | 25g | 2424.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-nitropyridine-3-carboxylic acid (CAS 2047-49-6) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 5-nitropyridine-3-carboxylic acid. InChIKey: TZAGBVHIUUFVCJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 5-nitropyridine-3-carboxylic acid |
| InChIKey | TZAGBVHIUUFVCJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)