5-Nitropicolinaldehyde, 98%, 98%
cas: 35969-75-6 — see every product listed under this CAS number, including other names
5-Nitropicolinaldehyde, 98%, 98% (CAS 35969-75-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CA0X-100mg |
| cas | 35969-75-6 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1509.20 Pln | |
| Chemat | 50g | 2680.40 Pln | |
| Chemat | 100g | 4749.20 Pln | |
| Chemat | 250g | 7437.20 Pln | |
| Chemat | 500g | 13416.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitropyridine-2-carbaldehyde (CAS 35969-75-6) is a chemical compound with the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. IUPAC name: 5-nitropyridine-2-carbaldehyde. InChIKey: NBHKYBWIGBFSRE-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O3 |
|---|---|
| Molecular weight | 152.11 g/mol |
| IUPAC name | 5-nitropyridine-2-carbaldehyde |
| InChIKey | NBHKYBWIGBFSRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)