Products 865061-50-3

CAS 865061-50-3 is the registry number for 7-Hydroxy-furo(3,4-b)pyrazin-5-one. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

3-formylpyrazine-2-carboxylic acid (CAS 865061-50-3) is a chemical compound with the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. IUPAC name: 3-formylpyrazine-2-carboxylic acid. InChIKey: CINFOIVLINCDLI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N2O3
Molecular weight152.11 g/mol
IUPAC name3-formylpyrazine-2-carboxylic acid
InChIKeyCINFOIVLINCDLI-UHFFFAOYSA-N
SMILESC1=CN=C(C(=N1)C=O)C(=O)O

Computed by PubChem (NCBI)