Products 914637-62-0

CAS 914637-62-0 is the registry number for Imidazo[1,2-b]isoxazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Imidazo[1,2-b][1,2]oxazole-2-carboxylic acid (CAS 914637-62-0) is a chemical compound with the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. IUPAC name: imidazo[1,2-b][1,2]oxazole-2-carboxylic acid. InChIKey: YTZBOHHWLAORTL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N2O3
Molecular weight152.11 g/mol
IUPAC nameimidazo[1,2-b][1,2]oxazole-2-carboxylic acid
InChIKeyYTZBOHHWLAORTL-UHFFFAOYSA-N
SMILESC1=CON2C1=NC(=C2)C(=O)O

Computed by PubChem (NCBI)