Products 2581226-18-6

CAS 2581226-18-6 is the registry number for 5-Cyano-4-methylisoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-cyano-4-methyl-1,2-oxazole-3-carboxylic acid (CAS 2581226-18-6) is a chemical compound with the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. IUPAC name: 5-cyano-4-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: VQGBSVXUQCGEAD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N2O3
Molecular weight152.11 g/mol
IUPAC name5-cyano-4-methyl-1,2-oxazole-3-carboxylic acid
InChIKeyVQGBSVXUQCGEAD-UHFFFAOYSA-N
SMILESCC1=C(ON=C1C(=O)O)C#N

Computed by PubChem (NCBI)