CAS 60698-32-0 is the registry number for 5-Phenoxy-2-furoic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
5-phenoxyfuran-2-carboxylic acid (CAS 60698-32-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 5-phenoxyfuran-2-carboxylic acid. InChIKey: QQKXTFLRAZKJJO-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 5-phenoxyfuran-2-carboxylic acid |
| InChIKey | QQKXTFLRAZKJJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)