CAS 89-35-0 appears in our catalog under these names: 3,5-Dihydroxy-2-naphthoic acid, 95%, 3,5-Dihydroxynapthalene-2-carboxylic Acid, >95% (HPLC), 3,5-Dihydroxy-2-naphthoic acid, 97%, 3,5–Dihydroxynapthalene–2–carboxylic Acid, UBP551/ 98.77% (existing batch purity). Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TargetMol. Available pack sizes: 1g, 5g, 25g, 10g, 5mg, 10mg, 25mg, 50mg.
3,5-dihydroxynaphthalene-2-carboxylic acid (CAS 89-35-0) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3,5-dihydroxynaphthalene-2-carboxylic acid. InChIKey: YELLAPKUWRTITI-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3,5-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | YELLAPKUWRTITI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)O)O)C(=O)O |
Computed by PubChem (NCBI)