CAS 3147-58-8 appears in our catalog under these names: 1,3-Dihydroxy-2-naphthoic acid, 97%, 1,3–Dihydroxy–2–naphthoic acid, 1,3-Dihydroxy-2-naphthoic acid, 1,3-Dihydroxy-2-naphthoic acid, 98%, 98%, 1,3-Dihydroxy-2-naphthoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 50mg, 2g, 100mg.
1,3-dihydroxynaphthalene-2-carboxylic acid (CAS 3147-58-8) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 1,3-dihydroxynaphthalene-2-carboxylic acid. InChIKey: USZZLTVYRPLBMB-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1,3-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | USZZLTVYRPLBMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2O)C(=O)O)O |
Computed by PubChem (NCBI)